C6H10FN — CID 138577129
N-(1-fluoroethyl)buta-1,3-dien-2-amine (PubChem CID 138577129) has the molecular formula C6H10FN and a molecular weight of 115.15 g/mol. Its IUPAC name is N-(1-fluoroethyl)buta-1,3-dien-2-amine.
| Compound Name | N-(1-fluoroethyl)buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 138577129 |
| Molecular Formula | C6H10FN |
| Molecular Weight | 115.15 g/mol |
| Exact Mass | 115.08 |
| IUPAC Name | N-(1-fluoroethyl)buta-1,3-dien-2-amine |
| SMILES | C=CC(=C)NC(C)F |
| InChI | InChI=1S/C6H10FN/c1-4-5(2)8-6(3)7/h4,6,8H,1-2H2,3H3 |
| InChIKey | MCOQLALCVPLCKY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.15 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|