C5H8FN — CID 137389650
N-(fluoromethyl)buta-1,3-dien-2-amine (PubChem CID 137389650) has the molecular formula C5H8FN and a molecular weight of 101.12 g/mol. Its IUPAC name is N-(fluoromethyl)buta-1,3-dien-2-amine.
| Compound Name | N-(fluoromethyl)buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 137389650 |
| Molecular Formula | C5H8FN |
| Molecular Weight | 101.12 g/mol |
| Exact Mass | 101.06 |
| IUPAC Name | N-(fluoromethyl)buta-1,3-dien-2-amine |
| SMILES | C=CC(=C)NCF |
| InChI | InChI=1S/C5H8FN/c1-3-5(2)7-4-6/h3,7H,1-2,4H2 |
| InChIKey | GYADZISDEDYMMJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 101.12 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|