C9H17FN2 — CID 138664249
(1Z)-1-N-(1-fluoroethyl)-3-N-propylbuta-1,3-diene-1,3-diamine (PubChem CID 138664249) has the molecular formula C9H17FN2 and a molecular weight of 172.25 g/mol. Its IUPAC name is (1Z)-1-N-(1-fluoroethyl)-3-N-propylbuta-1,3-diene-1,3-diamine.
| Compound Name | (1Z)-1-N-(1-fluoroethyl)-3-N-propylbuta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 138664249 |
| Molecular Formula | C9H17FN2 |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.14 |
| IUPAC Name | (1Z)-1-N-(1-fluoroethyl)-3-N-propylbuta-1,3-diene-1,3-diamine |
| SMILES | C=C(/C=C\NC(C)F)NCCC |
| InChI | InChI=1S/C9H17FN2/c1-4-6-11-8(2)5-7-12-9(3)10/h5,7,9,11-12H,2,4,6H2,1,3H3/b7-5- |
| InChIKey | ICEBQRHKTRJQOA-ALCCZGGFSA-N |
| XLogP | 1.92 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|