C13H23FN2 — CID 142931699
(3Z,5E)-7-fluoro-5-N-methyl-2-N-(2-methylbutyl)hepta-1,3,5-triene-2,5-diamine (PubChem CID 142931699) has the molecular formula C13H23FN2 and a molecular weight of 226.34 g/mol. Its IUPAC name is (3Z,5E)-7-fluoro-5-N-methyl-2-N-(2-methylbutyl)hepta-1,3,5-triene-2,5-diamine.
| Compound Name | (3Z,5E)-7-fluoro-5-N-methyl-2-N-(2-methylbutyl)hepta-1,3,5-triene-2,5-diamine |
|---|---|
| PubChem CID | 142931699 |
| Molecular Formula | C13H23FN2 |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | (3Z,5E)-7-fluoro-5-N-methyl-2-N-(2-methylbutyl)hepta-1,3,5-triene-2,5-diamine |
| SMILES | C=C(/C=C\C(=C/CF)NC)NCC(C)CC |
| InChI | InChI=1S/C13H23FN2/c1-5-11(2)10-16-12(3)6-7-13(15-4)8-9-14/h6-8,11,15-16H,3,5,9-10H2,1-2,4H3/b7-6-,13-8+ |
| InChIKey | BHCFZYYPWVVWJP-ONVRAGQBSA-N |
| XLogP | 2.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|