C11H21N — CID 89199351
(2S)-4-methyl-N-[(3Z)-penta-1,3-dien-2-yl]pentan-2-amine (PubChem CID 89199351) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (2S)-4-methyl-N-[(3Z)-penta-1,3-dien-2-yl]pentan-2-amine.
| Compound Name | (2S)-4-methyl-N-[(3Z)-penta-1,3-dien-2-yl]pentan-2-amine |
|---|---|
| PubChem CID | 89199351 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (2S)-4-methyl-N-[(3Z)-penta-1,3-dien-2-yl]pentan-2-amine |
| SMILES | C=C(/C=C\C)N[C@@H](C)CC(C)C |
| InChI | InChI=1S/C11H21N/c1-6-7-10(4)12-11(5)8-9(2)3/h6-7,9,11-12H,4,8H2,1-3,5H3/b7-6-/t11-/m0/s1 |
| InChIKey | RPJUMPLYUPWEJW-ZADCQDASSA-N |
| XLogP | 3.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|