C14H22FN — CID 142326450
(2E,4E)-2-ethenyl-5-fluoro-N-(3-methylpent-1-en-2-yl)hexa-2,4-dien-1-amine (PubChem CID 142326450) has the molecular formula C14H22FN and a molecular weight of 223.33 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-5-fluoro-N-(3-methylpent-1-en-2-yl)hexa-2,4-dien-1-amine.
| Compound Name | (2E,4E)-2-ethenyl-5-fluoro-N-(3-methylpent-1-en-2-yl)hexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142326450 |
| Molecular Formula | C14H22FN |
| Molecular Weight | 223.33 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | (2E,4E)-2-ethenyl-5-fluoro-N-(3-methylpent-1-en-2-yl)hexa-2,4-dien-1-amine |
| SMILES | C=C/C(=C\C=C(/C)F)CNC(=C)C(C)CC |
| InChI | InChI=1S/C14H22FN/c1-6-11(3)13(5)16-10-14(7-2)9-8-12(4)15/h7-9,11,16H,2,5-6,10H2,1,3-4H3/b12-8+,14-9+ |
| InChIKey | DDTJSYOFAYZHEJ-MXOVAJDFSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|