C14H21N — CID 145212515
(1Z,3Z,7Z,9Z)-N-methyl-5-methylidenedodeca-1,3,7,9-tetraen-1-amine (PubChem CID 145212515) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (1Z,3Z,7Z,9Z)-N-methyl-5-methylidenedodeca-1,3,7,9-tetraen-1-amine.
| Compound Name | (1Z,3Z,7Z,9Z)-N-methyl-5-methylidenedodeca-1,3,7,9-tetraen-1-amine |
|---|---|
| PubChem CID | 145212515 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (1Z,3Z,7Z,9Z)-N-methyl-5-methylidenedodeca-1,3,7,9-tetraen-1-amine |
| SMILES | C=C(/C=C\C=C/NC)C/C=C\C=C/CC |
| InChI | InChI=1S/C14H21N/c1-4-5-6-7-8-11-14(2)12-9-10-13-15-3/h5-10,12-13,15H,2,4,11H2,1,3H3/b6-5-,8-7-,12-9-,13-10- |
| InChIKey | MQAMXVSICZWVSA-GUWLATERSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|