C8H12O2 — CID 143180515
(3Z)-5-methylidenehepta-1,3-diene-2,6-diol (PubChem CID 143180515) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (3Z)-5-methylidenehepta-1,3-diene-2,6-diol.
| Compound Name | (3Z)-5-methylidenehepta-1,3-diene-2,6-diol |
|---|---|
| PubChem CID | 143180515 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (3Z)-5-methylidenehepta-1,3-diene-2,6-diol |
| SMILES | C=C(O)/C=C\C(=C)C(C)O |
| InChI | InChI=1S/C8H12O2/c1-6(8(3)10)4-5-7(2)9/h4-5,8-10H,1-2H2,3H3/b5-4- |
| InChIKey | DHCVDCJAYYAYMN-PLNGDYQASA-N |
| XLogP | 1.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|