C12H18O2 — CID 88529646
(3Z)-5-propan-2-ylidenenona-1,3,8-triene-2,7-diol (PubChem CID 88529646) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (3Z)-5-propan-2-ylidenenona-1,3,8-triene-2,7-diol.
| Compound Name | (3Z)-5-propan-2-ylidenenona-1,3,8-triene-2,7-diol |
|---|---|
| PubChem CID | 88529646 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (3Z)-5-propan-2-ylidenenona-1,3,8-triene-2,7-diol |
| SMILES | C=CC(O)CC(/C=C\C(=C)O)=C(C)C |
| InChI | InChI=1S/C12H18O2/c1-5-12(14)8-11(9(2)3)7-6-10(4)13/h5-7,12-14H,1,4,8H2,2-3H3/b7-6- |
| InChIKey | VQSHUVRINGBYLN-SREVYHEPSA-N |
| XLogP | 2.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|