C7H12O2 — CID 142059054
(3S)-5-methylhexa-1,4-diene-3,4-diol (PubChem CID 142059054) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is (3S)-5-methylhexa-1,4-diene-3,4-diol.
| Compound Name | (3S)-5-methylhexa-1,4-diene-3,4-diol |
|---|---|
| PubChem CID | 142059054 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | (3S)-5-methylhexa-1,4-diene-3,4-diol |
| SMILES | C=C[C@H](O)C(O)=C(C)C |
| InChI | InChI=1S/C7H12O2/c1-4-6(8)7(9)5(2)3/h4,6,8-9H,1H2,2-3H3/t6-/m0/s1 |
| InChIKey | GQDMNAPFXXYWOR-LURJTMIESA-N |
| XLogP | 1.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|