C8H12Y — CID 158513176
3-ethenyl-2-methylpenta-1,4-diene;yttrium (PubChem CID 158513176) has the molecular formula C8H12Y and a molecular weight of 197.09 g/mol. Its IUPAC name is 3-ethenyl-2-methylpenta-1,4-diene;yttrium.
| Compound Name | 3-ethenyl-2-methylpenta-1,4-diene;yttrium |
|---|---|
| PubChem CID | 158513176 |
| Molecular Formula | C8H12Y |
| Molecular Weight | 197.09 g/mol |
| Exact Mass | 197.00 |
| IUPAC Name | 3-ethenyl-2-methylpenta-1,4-diene;yttrium |
| SMILES | C=CC(C=C)C(=C)C.[Y] |
| InChI | InChI=1S/C8H12.Y/c1-5-8(6-2)7(3)4;/h5-6,8H,1-3H2,4H3; |
| InChIKey | HLHSJTSOSDPYQP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.09 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|