C8H11NO5S — CID 121277244
[(3E,5E)-6-nitrohepta-1,3,5-trien-3-yl] methanesulfonate (PubChem CID 121277244) has the molecular formula C8H11NO5S and a molecular weight of 233.24 g/mol. Its IUPAC name is [(3E,5E)-6-nitrohepta-1,3,5-trien-3-yl] methanesulfonate.
| Compound Name | [(3E,5E)-6-nitrohepta-1,3,5-trien-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 121277244 |
| Molecular Formula | C8H11NO5S |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | [(3E,5E)-6-nitrohepta-1,3,5-trien-3-yl] methanesulfonate |
| SMILES | C=C/C(=C\C=C(/C)[N+](=O)[O-])OS(C)(=O)=O |
| InChI | InChI=1S/C8H11NO5S/c1-4-8(14-15(3,12)13)6-5-7(2)9(10)11/h4-6H,1H2,2-3H3/b7-5+,8-6+ |
| InChIKey | XENXBABASJCMQX-KQQUZDAGSA-N |
| XLogP | 1.21 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|