C24H37NO2 — CID 142094388
ethane;1-[(3E)-3-ethenyl-4-nitrohexa-3,5-dienyl]-4-methylbenzene;2-methylbuta-1,3-diene (PubChem CID 142094388) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is ethane;1-[(3E)-3-ethenyl-4-nitrohexa-3,5-dienyl]-4-methylbenzene;2-methylbuta-1,3-diene.
| Compound Name | ethane;1-[(3E)-3-ethenyl-4-nitrohexa-3,5-dienyl]-4-methylbenzene;2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 142094388 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | ethane;1-[(3E)-3-ethenyl-4-nitrohexa-3,5-dienyl]-4-methylbenzene;2-methylbuta-1,3-diene |
| SMILES | C=C/C(CCc1ccc(C)cc1)=C(\C=C)[N+](=O)[O-].C=CC(=C)C.CC.CC |
| InChI | InChI=1S/C15H17NO2.C5H8.2C2H6/c1-4-14(15(5-2)16(17)18)11-10-13-8-6-12(3)7-9-13;1-4-5(2)3;2*1-2/h4-9H,1-2,10-11H2,3H3;4H,1-2H2,3H3;2*1-2H3/b15-14-;;; |
| InChIKey | RDMVPAAHHKLVEH-VBPHADAZSA-N |
| XLogP | 7.63 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|