C13H12N2O6 — CID 177396393
[(1Z,3E)-2-nitrohexa-1,3,5-trienyl] (2Z,4E)-3-nitrohepta-2,4,6-trienoate (PubChem CID 177396393) has the molecular formula C13H12N2O6 and a molecular weight of 292.25 g/mol. Its IUPAC name is [(1Z,3E)-2-nitrohexa-1,3,5-trienyl] (2Z,4E)-3-nitrohepta-2,4,6-trienoate.
| Compound Name | [(1Z,3E)-2-nitrohexa-1,3,5-trienyl] (2Z,4E)-3-nitrohepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 177396393 |
| Molecular Formula | C13H12N2O6 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | [(1Z,3E)-2-nitrohexa-1,3,5-trienyl] (2Z,4E)-3-nitrohepta-2,4,6-trienoate |
| SMILES | C=C/C=C/C(=C/OC(=O)/C=C(/C=C/C=C)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C13H12N2O6/c1-3-5-7-11(14(17)18)9-13(16)21-10-12(15(19)20)8-6-4-2/h3-10H,1-2H2/b7-5+,8-6+,11-9-,12-10- |
| InChIKey | DEUGZZRZAXOOOI-HRDGMQANSA-N |
| XLogP | 2.29 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|