C10H12O2 — CID 134872844
[(1E)-buta-1,3-dienyl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 134872844) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is [(1E)-buta-1,3-dienyl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [(1E)-buta-1,3-dienyl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 134872844 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | [(1E)-buta-1,3-dienyl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C=C/C=C/OC(=O)/C=C/C=C/C |
| InChI | InChI=1S/C10H12O2/c1-3-5-7-8-10(11)12-9-6-4-2/h3-9H,2H2,1H3/b5-3+,8-7+,9-6+ |
| InChIKey | SJHHCKKTDCAPGX-ULHKCZBESA-N |
| XLogP | 2.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|