C8H8O4 — CID 141223387
(Z)-4-[(1E)-buta-1,3-dienoxy]-4-oxobut-2-enoic acid (PubChem CID 141223387) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is (Z)-4-[(1E)-buta-1,3-dienoxy]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[(1E)-buta-1,3-dienoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 141223387 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | (Z)-4-[(1E)-buta-1,3-dienoxy]-4-oxobut-2-enoic acid |
| SMILES | C=C/C=C/OC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C8H8O4/c1-2-3-6-12-8(11)5-4-7(9)10/h2-6H,1H2,(H,9,10)/b5-4-,6-3+ |
| InChIKey | ZHNROTZWCOQQCE-XNYOYJNRSA-N |
| XLogP | 0.87 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|