C12H16O4 — CID 87949765
(Z)-4-octa-1,3-dienoxy-4-oxobut-2-enoic acid (PubChem CID 87949765) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (Z)-4-octa-1,3-dienoxy-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-octa-1,3-dienoxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 87949765 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (Z)-4-octa-1,3-dienoxy-4-oxobut-2-enoic acid |
| SMILES | CCCCC=CC=COC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C12H16O4/c1-2-3-4-5-6-7-10-16-12(15)9-8-11(13)14/h5-10H,2-4H2,1H3,(H,13,14)/b6-5?,9-8-,10-7? |
| InChIKey | XBUMZXALUFUQPY-RAZIYNIQSA-N |
| XLogP | 2.43 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|