About but-1-enyl (2E,4E)-hexa-2,4-dienoate
but-1-enyl (2E,4E)-hexa-2,4-dienoate (PubChem CID 170458359) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is but-1-enyl (2E,4E)-hexa-2,4-dienoate.
Molecular Properties
| Compound Name | but-1-enyl (2E,4E)-hexa-2,4-dienoate |
| PubChem CID | 170458359 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | but-1-enyl (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)OC=CCC |
| InChI | InChI=1S/C10H14O2/c1-3-5-7-8-10(11)12-9-6-4-2/h3,5-9H,4H2,1-2H3/b5-3+,8-7+,9-6? |
| InChIKey | ZWLKDTGERSENHK-COFJZGKWSA-N |
| XLogP | 2.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze but-1-enyl (2E,4E)-hexa-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-enyl (2E,4E)-hexa-2,4-dienoate?
The IUPAC name of but-1-enyl (2E,4E)-hexa-2,4-dienoate (CID 170458359) is but-1-enyl (2E,4E)-hexa-2,4-dienoate.
What is the SMILES notation for but-1-enyl (2E,4E)-hexa-2,4-dienoate?
The canonical SMILES for but-1-enyl (2E,4E)-hexa-2,4-dienoate is C/C=C/C=C/C(=O)OC=CCC.
What is the InChIKey of but-1-enyl (2E,4E)-hexa-2,4-dienoate?
The InChIKey is ZWLKDTGERSENHK-COFJZGKWSA-N. The full InChI is InChI=1S/C10H14O2/c1-3-5-7-8-10(11)12-9-6-4-2/h3,5-9H,4H2,1-2H3/b5-3+,8-7+,9-6?.
What are the key properties of but-1-enyl (2E,4E)-hexa-2,4-dienoate?
but-1-enyl (2E,4E)-hexa-2,4-dienoate has a molecular weight of 166.22 g/mol, XLogP of 2.59, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-enyl (2E,4E)-hexa-2,4-dienoate is sourced from PubChem (CID 170458359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).