About but-1-enyl 3-(4-hydroxyphenyl)prop-2-enoate
but-1-enyl 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 142738218) has the molecular formula C13H14O3
and a molecular weight of 218.25 g/mol. Its IUPAC name is but-1-enyl 3-(4-hydroxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | but-1-enyl 3-(4-hydroxyphenyl)prop-2-enoate |
| PubChem CID | 142738218 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | but-1-enyl 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | CCC=COC(=O)C=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C13H14O3/c1-2-3-10-16-13(15)9-6-11-4-7-12(14)8-5-11/h3-10,14H,2H2,1H3 |
| InChIKey | NXLKRPUYSUVKKQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-1-enyl 3-(4-hydroxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-enyl 3-(4-hydroxyphenyl)prop-2-enoate?
The IUPAC name of but-1-enyl 3-(4-hydroxyphenyl)prop-2-enoate (CID 142738218) is but-1-enyl 3-(4-hydroxyphenyl)prop-2-enoate.
What is the SMILES notation for but-1-enyl 3-(4-hydroxyphenyl)prop-2-enoate?
The canonical SMILES for but-1-enyl 3-(4-hydroxyphenyl)prop-2-enoate is CCC=COC(=O)C=Cc1ccc(O)cc1.
What is the InChIKey of but-1-enyl 3-(4-hydroxyphenyl)prop-2-enoate?
The InChIKey is NXLKRPUYSUVKKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O3/c1-2-3-10-16-13(15)9-6-11-4-7-12(14)8-5-11/h3-10,14H,2H2,1H3.
What are the key properties of but-1-enyl 3-(4-hydroxyphenyl)prop-2-enoate?
but-1-enyl 3-(4-hydroxyphenyl)prop-2-enoate has a molecular weight of 218.25 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-enyl 3-(4-hydroxyphenyl)prop-2-enoate is sourced from PubChem (CID 142738218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).