C13H23Cl — CID 167238978
6-(1-chloroethenyl)-2,3-dimethylnon-1-ene (PubChem CID 167238978) has the molecular formula C13H23Cl and a molecular weight of 214.78 g/mol. Its IUPAC name is 6-(1-chloroethenyl)-2,3-dimethylnon-1-ene.
| Compound Name | 6-(1-chloroethenyl)-2,3-dimethylnon-1-ene |
|---|---|
| PubChem CID | 167238978 |
| Molecular Formula | C13H23Cl |
| Molecular Weight | 214.78 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 6-(1-chloroethenyl)-2,3-dimethylnon-1-ene |
| SMILES | C=C(C)C(C)CCC(CCC)C(=C)Cl |
| InChI | InChI=1S/C13H23Cl/c1-6-7-13(12(5)14)9-8-11(4)10(2)3/h11,13H,2,5-9H2,1,3-4H3 |
| InChIKey | JGSOIDVKYNFQPU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.78 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|