About (2R)-2-methylpentanoyl chloride
(2R)-2-methylpentanoyl chloride (PubChem CID 7160703) has the molecular formula C6H11ClO
and a molecular weight of 134.61 g/mol. Its IUPAC name is (2R)-2-methylpentanoyl chloride.
Molecular Properties
| Compound Name | (2R)-2-methylpentanoyl chloride |
| PubChem CID | 7160703 |
| Molecular Formula | C6H11ClO |
| Molecular Weight | 134.61 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | (2R)-2-methylpentanoyl chloride |
| SMILES | CCC[C@@H](C)C(=O)Cl |
| InChI | InChI=1S/C6H11ClO/c1-3-4-5(2)6(7)8/h5H,3-4H2,1-2H3/t5-/m1/s1 |
| InChIKey | MFIQXAVMTLKUJR-RXMQYKEDSA-N |
| XLogP | 2.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.61 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-methylpentanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methylpentanoyl chloride?
The IUPAC name of (2R)-2-methylpentanoyl chloride (CID 7160703) is (2R)-2-methylpentanoyl chloride.
What is the SMILES notation for (2R)-2-methylpentanoyl chloride?
The canonical SMILES for (2R)-2-methylpentanoyl chloride is CCC[C@@H](C)C(=O)Cl.
What is the InChIKey of (2R)-2-methylpentanoyl chloride?
The InChIKey is MFIQXAVMTLKUJR-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H11ClO/c1-3-4-5(2)6(7)8/h5H,3-4H2,1-2H3/t5-/m1/s1.
What are the key properties of (2R)-2-methylpentanoyl chloride?
(2R)-2-methylpentanoyl chloride has a molecular weight of 134.61 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methylpentanoyl chloride is sourced from PubChem (CID 7160703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).