C13H24 — CID 159199153
(3R)-2,3-dimethylpent-1-ene;(3R)-3-methylpent-1-yne (PubChem CID 159199153) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is (3R)-2,3-dimethylpent-1-ene;(3R)-3-methylpent-1-yne.
| Compound Name | (3R)-2,3-dimethylpent-1-ene;(3R)-3-methylpent-1-yne |
|---|---|
| PubChem CID | 159199153 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | (3R)-2,3-dimethylpent-1-ene;(3R)-3-methylpent-1-yne |
| SMILES | C#C[C@H](C)CC.C=C(C)[C@H](C)CC |
| InChI | InChI=1S/C7H14.C6H10/c1-5-7(4)6(2)3;1-4-6(3)5-2/h7H,2,5H2,1,3-4H3;1,6H,5H2,2-3H3/t7-;6-/m10/s1 |
| InChIKey | KPBAQACQMILANC-MNZRUBAUSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|