C3H13N3O — CID 159816224
N,N-dimethylhydroxylamine;methylhydrazine (PubChem CID 159816224) has the molecular formula C3H13N3O and a molecular weight of 107.16 g/mol. Its IUPAC name is N,N-dimethylhydroxylamine;methylhydrazine.
| Compound Name | N,N-dimethylhydroxylamine;methylhydrazine |
|---|---|
| PubChem CID | 159816224 |
| Molecular Formula | C3H13N3O |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.11 |
| IUPAC Name | N,N-dimethylhydroxylamine;methylhydrazine |
| SMILES | CN(C)O.CNN |
| InChI | InChI=1S/C2H7NO.CH6N2/c1-3(2)4;1-3-2/h4H,1-2H3;3H,2H2,1H3 |
| InChIKey | NLQPGVLHQBMMTI-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|