C4H14ClNO — CID 19353059
N,N-dimethylhydroxylamine;ethane;hydrochloride (PubChem CID 19353059) has the molecular formula C4H14ClNO and a molecular weight of 127.61 g/mol. Its IUPAC name is N,N-dimethylhydroxylamine;ethane;hydrochloride.
| Compound Name | N,N-dimethylhydroxylamine;ethane;hydrochloride |
|---|---|
| PubChem CID | 19353059 |
| Molecular Formula | C4H14ClNO |
| Molecular Weight | 127.61 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | N,N-dimethylhydroxylamine;ethane;hydrochloride |
| SMILES | CC.CN(C)O.Cl |
| InChI | InChI=1S/C2H7NO.C2H6.ClH/c1-3(2)4;1-2;/h4H,1-2H3;1-2H3;1H |
| InChIKey | BHZICRBLIXVIOU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.61 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|