About N,N-dimethylhydroxylamine;hydrazine
N,N-dimethylhydroxylamine;hydrazine (PubChem CID 158073079) has the molecular formula C2H11N3O
and a molecular weight of 93.13 g/mol. Its IUPAC name is N,N-dimethylhydroxylamine;hydrazine.
Molecular Properties
| Compound Name | N,N-dimethylhydroxylamine;hydrazine |
| PubChem CID | 158073079 |
| Molecular Formula | C2H11N3O |
| Molecular Weight | 93.13 g/mol |
| Exact Mass | 93.09 |
| IUPAC Name | N,N-dimethylhydroxylamine;hydrazine |
| SMILES | CN(C)O.NN |
| InChI | InChI=1S/C2H7NO.H4N2/c1-3(2)4;1-2/h4H,1-2H3;1-2H2 |
| InChIKey | FMAUAXGLGGSLJN-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 93.13 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylhydroxylamine;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylhydroxylamine;hydrazine?
The IUPAC name of N,N-dimethylhydroxylamine;hydrazine (CID 158073079) is N,N-dimethylhydroxylamine;hydrazine.
What is the SMILES notation for N,N-dimethylhydroxylamine;hydrazine?
The canonical SMILES for N,N-dimethylhydroxylamine;hydrazine is CN(C)O.NN.
What is the InChIKey of N,N-dimethylhydroxylamine;hydrazine?
The InChIKey is FMAUAXGLGGSLJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NO.H4N2/c1-3(2)4;1-2/h4H,1-2H3;1-2H2.
What are the key properties of N,N-dimethylhydroxylamine;hydrazine?
N,N-dimethylhydroxylamine;hydrazine has a molecular weight of 93.13 g/mol, XLogP of -1.24, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylhydroxylamine;hydrazine is sourced from PubChem (CID 158073079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).