About N,N-dimethylethanethioamide;hydrazine
N,N-dimethylethanethioamide;hydrazine (PubChem CID 159847458) has the molecular formula C4H13N3S
and a molecular weight of 135.24 g/mol. Its IUPAC name is N,N-dimethylethanethioamide;hydrazine.
Molecular Properties
| Compound Name | N,N-dimethylethanethioamide;hydrazine |
| PubChem CID | 159847458 |
| Molecular Formula | C4H13N3S |
| Molecular Weight | 135.24 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | N,N-dimethylethanethioamide;hydrazine |
| SMILES | CC(=S)N(C)C.NN |
| InChI | InChI=1S/C4H9NS.H4N2/c1-4(6)5(2)3;1-2/h1-3H3;1-2H2 |
| InChIKey | NPMNHDYIIZNOTG-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.24 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylethanethioamide;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylethanethioamide;hydrazine?
The IUPAC name of N,N-dimethylethanethioamide;hydrazine (CID 159847458) is N,N-dimethylethanethioamide;hydrazine.
What is the SMILES notation for N,N-dimethylethanethioamide;hydrazine?
The canonical SMILES for N,N-dimethylethanethioamide;hydrazine is CC(=S)N(C)C.NN.
What is the InChIKey of N,N-dimethylethanethioamide;hydrazine?
The InChIKey is NPMNHDYIIZNOTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NS.H4N2/c1-4(6)5(2)3;1-2/h1-3H3;1-2H2.
What are the key properties of N,N-dimethylethanethioamide;hydrazine?
N,N-dimethylethanethioamide;hydrazine has a molecular weight of 135.24 g/mol, XLogP of -0.29, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylethanethioamide;hydrazine is sourced from PubChem (CID 159847458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).