C7H13NOS — CID 135963002
(E)-3-hydroxy-N,N,2-trimethylbut-2-enethioamide (PubChem CID 135963002) has the molecular formula C7H13NOS and a molecular weight of 159.25 g/mol. Its IUPAC name is (E)-3-hydroxy-N,N,2-trimethylbut-2-enethioamide.
| Compound Name | (E)-3-hydroxy-N,N,2-trimethylbut-2-enethioamide |
|---|---|
| PubChem CID | 135963002 |
| Molecular Formula | C7H13NOS |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | (E)-3-hydroxy-N,N,2-trimethylbut-2-enethioamide |
| SMILES | C/C(O)=C(/C)C(=S)N(C)C |
| InChI | InChI=1S/C7H13NOS/c1-5(6(2)9)7(10)8(3)4/h9H,1-4H3/b6-5+ |
| InChIKey | VZXAELVIBQEJFD-AATRIKPKSA-N |
| XLogP | 1.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|