C4H11N3S — CID 13157232
1-amino-1,3,3-trimethylthiourea (PubChem CID 13157232) has the molecular formula C4H11N3S and a molecular weight of 133.22 g/mol. Its IUPAC name is 1-amino-1,3,3-trimethylthiourea.
| Compound Name | 1-amino-1,3,3-trimethylthiourea |
|---|---|
| PubChem CID | 13157232 |
| Molecular Formula | C4H11N3S |
| Molecular Weight | 133.22 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 1-amino-1,3,3-trimethylthiourea |
| SMILES | CN(C)C(=S)N(C)N |
| InChI | InChI=1S/C4H11N3S/c1-6(2)4(8)7(3)5/h5H2,1-3H3 |
| InChIKey | KNCAVFLXUQLOBR-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.22 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|