About N,N-dimethylmethanamine;hydrazine;hydroiodide
N,N-dimethylmethanamine;hydrazine;hydroiodide (PubChem CID 173045111) has the molecular formula C3H14IN3
and a molecular weight of 219.07 g/mol. Its IUPAC name is N,N-dimethylmethanamine;hydrazine;hydroiodide.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;hydrazine;hydroiodide |
| PubChem CID | 173045111 |
| Molecular Formula | C3H14IN3 |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | N,N-dimethylmethanamine;hydrazine;hydroiodide |
| SMILES | CN(C)C.I.NN |
| InChI | InChI=1S/C3H9N.HI.H4N2/c1-4(2)3;;1-2/h1-3H3;1H;1-2H2 |
| InChIKey | LIRGAZZENMPMNY-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;hydrazine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;hydrazine;hydroiodide?
The IUPAC name of N,N-dimethylmethanamine;hydrazine;hydroiodide (CID 173045111) is N,N-dimethylmethanamine;hydrazine;hydroiodide.
What is the SMILES notation for N,N-dimethylmethanamine;hydrazine;hydroiodide?
The canonical SMILES for N,N-dimethylmethanamine;hydrazine;hydroiodide is CN(C)C.I.NN.
What is the InChIKey of N,N-dimethylmethanamine;hydrazine;hydroiodide?
The InChIKey is LIRGAZZENMPMNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.HI.H4N2/c1-4(2)3;;1-2/h1-3H3;1H;1-2H2.
What are the key properties of N,N-dimethylmethanamine;hydrazine;hydroiodide?
N,N-dimethylmethanamine;hydrazine;hydroiodide has a molecular weight of 219.07 g/mol, XLogP of -0.39, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;hydrazine;hydroiodide is sourced from PubChem (CID 173045111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).