About N,N-dimethylhydroxylamine;ethene
N,N-dimethylhydroxylamine;ethene (PubChem CID 91261620) has the molecular formula C4H11NO
and a molecular weight of 89.14 g/mol. Its IUPAC name is N,N-dimethylhydroxylamine;ethene.
Molecular Properties
| Compound Name | N,N-dimethylhydroxylamine;ethene |
| PubChem CID | 91261620 |
| Molecular Formula | C4H11NO |
| Molecular Weight | 89.14 g/mol |
| Exact Mass | 89.08 |
| IUPAC Name | N,N-dimethylhydroxylamine;ethene |
| SMILES | C=C.CN(C)O |
| InChI | InChI=1S/C2H7NO.C2H4/c1-3(2)4;1-2/h4H,1-2H3;1-2H2 |
| InChIKey | OFFGKLSSFJUINA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.14 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylhydroxylamine;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylhydroxylamine;ethene?
The IUPAC name of N,N-dimethylhydroxylamine;ethene (CID 91261620) is N,N-dimethylhydroxylamine;ethene.
What is the SMILES notation for N,N-dimethylhydroxylamine;ethene?
The canonical SMILES for N,N-dimethylhydroxylamine;ethene is C=C.CN(C)O.
What is the InChIKey of N,N-dimethylhydroxylamine;ethene?
The InChIKey is OFFGKLSSFJUINA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NO.C2H4/c1-3(2)4;1-2/h4H,1-2H3;1-2H2.
What are the key properties of N,N-dimethylhydroxylamine;ethene?
N,N-dimethylhydroxylamine;ethene has a molecular weight of 89.14 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylhydroxylamine;ethene is sourced from PubChem (CID 91261620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).