About deuteriomethyl 2-methylidenebutanoate
deuteriomethyl 2-methylidenebutanoate (PubChem CID 174392551) has the molecular formula C6H10O2
and a molecular weight of 115.15 g/mol. Its IUPAC name is deuteriomethyl 2-methylidenebutanoate.
Molecular Properties
| Compound Name | deuteriomethyl 2-methylidenebutanoate |
| PubChem CID | 174392551 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 115.15 g/mol |
| Exact Mass | 115.07 |
| IUPAC Name | deuteriomethyl 2-methylidenebutanoate |
| SMILES | [2H]COC(=O)C(=C)CC |
| InChI | InChI=1S/C6H10O2/c1-4-5(2)6(7)8-3/h2,4H2,1,3H3/i3D |
| InChIKey | JKJJSJJGBZXUQV-WFVSFCRTSA-N |
| XLogP | 1.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.15 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze deuteriomethyl 2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuteriomethyl 2-methylidenebutanoate?
The IUPAC name of deuteriomethyl 2-methylidenebutanoate (CID 174392551) is deuteriomethyl 2-methylidenebutanoate.
What is the SMILES notation for deuteriomethyl 2-methylidenebutanoate?
The canonical SMILES for deuteriomethyl 2-methylidenebutanoate is [2H]COC(=O)C(=C)CC.
What is the InChIKey of deuteriomethyl 2-methylidenebutanoate?
The InChIKey is JKJJSJJGBZXUQV-WFVSFCRTSA-N. The full InChI is InChI=1S/C6H10O2/c1-4-5(2)6(7)8-3/h2,4H2,1,3H3/i3D.
What are the key properties of deuteriomethyl 2-methylidenebutanoate?
deuteriomethyl 2-methylidenebutanoate has a molecular weight of 115.15 g/mol, XLogP of 1.13, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for deuteriomethyl 2-methylidenebutanoate is sourced from PubChem (CID 174392551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).