About 2-methylidene-N,N-dipropylhexanamide
2-methylidene-N,N-dipropylhexanamide (PubChem CID 87269108) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is 2-methylidene-N,N-dipropylhexanamide.
Molecular Properties
| Compound Name | 2-methylidene-N,N-dipropylhexanamide |
| PubChem CID | 87269108 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 2-methylidene-N,N-dipropylhexanamide |
| SMILES | C=C(CCCC)C(=O)N(CCC)CCC |
| InChI | InChI=1S/C13H25NO/c1-5-8-9-12(4)13(15)14(10-6-2)11-7-3/h4-11H2,1-3H3 |
| InChIKey | XCUIHLATKFWDLD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidene-N,N-dipropylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-N,N-dipropylhexanamide?
The IUPAC name of 2-methylidene-N,N-dipropylhexanamide (CID 87269108) is 2-methylidene-N,N-dipropylhexanamide.
What is the SMILES notation for 2-methylidene-N,N-dipropylhexanamide?
The canonical SMILES for 2-methylidene-N,N-dipropylhexanamide is C=C(CCCC)C(=O)N(CCC)CCC.
What is the InChIKey of 2-methylidene-N,N-dipropylhexanamide?
The InChIKey is XCUIHLATKFWDLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO/c1-5-8-9-12(4)13(15)14(10-6-2)11-7-3/h4-11H2,1-3H3.
What are the key properties of 2-methylidene-N,N-dipropylhexanamide?
2-methylidene-N,N-dipropylhexanamide has a molecular weight of 211.35 g/mol, XLogP of 3.38, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-N,N-dipropylhexanamide is sourced from PubChem (CID 87269108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).