C12H23NO — CID 87269106
2-methylidene-N,N-di(propan-2-yl)pentanamide (PubChem CID 87269106) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 2-methylidene-N,N-di(propan-2-yl)pentanamide.
| Compound Name | 2-methylidene-N,N-di(propan-2-yl)pentanamide |
|---|---|
| PubChem CID | 87269106 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2-methylidene-N,N-di(propan-2-yl)pentanamide |
| SMILES | C=C(CCC)C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C12H23NO/c1-7-8-11(6)12(14)13(9(2)3)10(4)5/h9-10H,6-8H2,1-5H3 |
| InChIKey | WYNZFGVFCWKCRA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|