About N-methyl-2-methylidene-N'-propylpropanediamide
N-methyl-2-methylidene-N'-propylpropanediamide (PubChem CID 102186954) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is N-methyl-2-methylidene-N'-propylpropanediamide.
Molecular Properties
| Compound Name | N-methyl-2-methylidene-N'-propylpropanediamide |
| PubChem CID | 102186954 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | N-methyl-2-methylidene-N'-propylpropanediamide |
| SMILES | C=C(C(=O)NC)C(=O)NCCC |
| InChI | InChI=1S/C8H14N2O2/c1-4-5-10-8(12)6(2)7(11)9-3/h2,4-5H2,1,3H3,(H,9,11)(H,10,12) |
| InChIKey | UFNYYJOCQOILSJ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-2-methylidene-N'-propylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-methylidene-N'-propylpropanediamide?
The IUPAC name of N-methyl-2-methylidene-N'-propylpropanediamide (CID 102186954) is N-methyl-2-methylidene-N'-propylpropanediamide.
What is the SMILES notation for N-methyl-2-methylidene-N'-propylpropanediamide?
The canonical SMILES for N-methyl-2-methylidene-N'-propylpropanediamide is C=C(C(=O)NC)C(=O)NCCC.
What is the InChIKey of N-methyl-2-methylidene-N'-propylpropanediamide?
The InChIKey is UFNYYJOCQOILSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-4-5-10-8(12)6(2)7(11)9-3/h2,4-5H2,1,3H3,(H,9,11)(H,10,12).
What are the key properties of N-methyl-2-methylidene-N'-propylpropanediamide?
N-methyl-2-methylidene-N'-propylpropanediamide has a molecular weight of 170.21 g/mol, XLogP of -0.19, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-methylidene-N'-propylpropanediamide is sourced from PubChem (CID 102186954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).