C13H24N4O2 — CID 123468572
(Z)-2-(C,N-dimethylcarbonimidoyl)-N-methyl-3-[methyl(propyl)amino]pent-2-enediamide (PubChem CID 123468572) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is (Z)-2-(C,N-dimethylcarbonimidoyl)-N-methyl-3-[methyl(propyl)amino]pent-2-enediamide.
| Compound Name | (Z)-2-(C,N-dimethylcarbonimidoyl)-N-methyl-3-[methyl(propyl)amino]pent-2-enediamide |
|---|---|
| PubChem CID | 123468572 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | (Z)-2-(C,N-dimethylcarbonimidoyl)-N-methyl-3-[methyl(propyl)amino]pent-2-enediamide |
| SMILES | CCCN(C)/C(CC(N)=O)=C(C(=O)NC)/C(C)=N/C |
| InChI | InChI=1S/C13H24N4O2/c1-6-7-17(5)10(8-11(14)18)12(9(2)15-3)13(19)16-4/h6-8H2,1-5H3,(H2,14,18)(H,16,19)/b12-10-,15-9+ |
| InChIKey | AHHMBLLCHYIRBU-JKYVHAMPSA-N |
| XLogP | 0.29 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|