C9H18N5O2+ — CID 146694522
[4-amino-2-(2-amino-2-oxoethyl)-4-(methylamino)-3-(methylcarbamoyl)buta-1,3-dienyl]azanium (PubChem CID 146694522) has the molecular formula C9H18N5O2+ and a molecular weight of 228.28 g/mol. Its IUPAC name is [4-amino-2-(2-amino-2-oxoethyl)-4-(methylamino)-3-(methylcarbamoyl)buta-1,3-dienyl]azanium.
| Compound Name | [4-amino-2-(2-amino-2-oxoethyl)-4-(methylamino)-3-(methylcarbamoyl)buta-1,3-dienyl]azanium |
|---|---|
| PubChem CID | 146694522 |
| Molecular Formula | C9H18N5O2+ |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | [4-amino-2-(2-amino-2-oxoethyl)-4-(methylamino)-3-(methylcarbamoyl)buta-1,3-dienyl]azanium |
| SMILES | CNC(=O)C(C(=C[NH3+])CC(N)=O)=C(N)NC |
| InChI | InChI=1S/C9H17N5O2/c1-13-8(12)7(9(16)14-2)5(4-10)3-6(11)15/h4,13H,3,10,12H2,1-2H3,(H2,11,15)(H,14,16)/p+1 |
| InChIKey | QMVKLZBYEDBMAL-UHFFFAOYSA-O |
| XLogP | -2.88 |
| TPSA | 137.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|