C12H23NO4S — CID 115881165
methyl 4-[(3,3-dimethylcyclopentyl)sulfamoyl]butanoate (PubChem CID 115881165) has the molecular formula C12H23NO4S and a molecular weight of 277.39 g/mol. Its IUPAC name is methyl 4-[(3,3-dimethylcyclopentyl)sulfamoyl]butanoate.
| Compound Name | methyl 4-[(3,3-dimethylcyclopentyl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 115881165 |
| Molecular Formula | C12H23NO4S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | methyl 4-[(3,3-dimethylcyclopentyl)sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)NC1CCC(C)(C)C1 |
| InChI | InChI=1S/C12H23NO4S/c1-12(2)7-6-10(9-12)13-18(15,16)8-4-5-11(14)17-3/h10,13H,4-9H2,1-3H3 |
| InChIKey | VERJAMAXAJTPSU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |