C12H24ClNO3S — CID 65032978
N-[1-(chloromethyl)-4-methylcyclohexyl]-3-methoxypropane-1-sulfonamide (PubChem CID 65032978) has the molecular formula C12H24ClNO3S and a molecular weight of 297.85 g/mol. Its IUPAC name is N-[1-(chloromethyl)-4-methylcyclohexyl]-3-methoxypropane-1-sulfonamide.
| Compound Name | N-[1-(chloromethyl)-4-methylcyclohexyl]-3-methoxypropane-1-sulfonamide |
|---|---|
| PubChem CID | 65032978 |
| Molecular Formula | C12H24ClNO3S |
| Molecular Weight | 297.85 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-[1-(chloromethyl)-4-methylcyclohexyl]-3-methoxypropane-1-sulfonamide |
| SMILES | COCCCS(=O)(=O)NC1(CCl)CCC(C)CC1 |
| InChI | InChI=1S/C12H24ClNO3S/c1-11-4-6-12(10-13,7-5-11)14-18(15,16)9-3-8-17-2/h11,14H,3-10H2,1-2H3 |
| InChIKey | UYZVLXJDPVZTPW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.85 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|