C11H22BrNO3S — CID 114293958
N-[1-(bromomethyl)-3-methylcyclohexyl]-2-methoxyethanesulfonamide (PubChem CID 114293958) has the molecular formula C11H22BrNO3S and a molecular weight of 328.27 g/mol. Its IUPAC name is N-[1-(bromomethyl)-3-methylcyclohexyl]-2-methoxyethanesulfonamide.
| Compound Name | N-[1-(bromomethyl)-3-methylcyclohexyl]-2-methoxyethanesulfonamide |
|---|---|
| PubChem CID | 114293958 |
| Molecular Formula | C11H22BrNO3S |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-[1-(bromomethyl)-3-methylcyclohexyl]-2-methoxyethanesulfonamide |
| SMILES | COCCS(=O)(=O)NC1(CBr)CCCC(C)C1 |
| InChI | InChI=1S/C11H22BrNO3S/c1-10-4-3-5-11(8-10,9-12)13-17(14,15)7-6-16-2/h10,13H,3-9H2,1-2H3 |
| InChIKey | YCSQQRBCFVALGV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|