C13H22BrN3O2S — CID 114293922
N-[1-(bromomethyl)-3-methylcyclohexyl]-1-ethylimidazole-4-sulfonamide (PubChem CID 114293922) has the molecular formula C13H22BrN3O2S and a molecular weight of 364.31 g/mol. Its IUPAC name is N-[1-(bromomethyl)-3-methylcyclohexyl]-1-ethylimidazole-4-sulfonamide.
| Compound Name | N-[1-(bromomethyl)-3-methylcyclohexyl]-1-ethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 114293922 |
| Molecular Formula | C13H22BrN3O2S |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | N-[1-(bromomethyl)-3-methylcyclohexyl]-1-ethylimidazole-4-sulfonamide |
| SMILES | CCn1cnc(S(=O)(=O)NC2(CBr)CCCC(C)C2)c1 |
| InChI | InChI=1S/C13H22BrN3O2S/c1-3-17-8-12(15-10-17)20(18,19)16-13(9-14)6-4-5-11(2)7-13/h8,10-11,16H,3-7,9H2,1-2H3 |
| InChIKey | QOTWQIWPVGLZME-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|