C15H21NO3 — CID 107853772
ethyl 2-[2-(2,3-dihydro-1H-inden-2-ylamino)ethoxy]acetate (PubChem CID 107853772) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is ethyl 2-[2-(2,3-dihydro-1H-inden-2-ylamino)ethoxy]acetate.
| Compound Name | ethyl 2-[2-(2,3-dihydro-1H-inden-2-ylamino)ethoxy]acetate |
|---|---|
| PubChem CID | 107853772 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | ethyl 2-[2-(2,3-dihydro-1H-inden-2-ylamino)ethoxy]acetate |
| SMILES | CCOC(=O)COCCNC1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H21NO3/c1-2-19-15(17)11-18-8-7-16-14-9-12-5-3-4-6-13(12)10-14/h3-6,14,16H,2,7-11H2,1H3 |
| InChIKey | MVFIHTNXCDEAQC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|