C13H22N2O2 — CID 79359765
2-methyl-4-[(2-propan-2-yloxy-3-pyridinyl)amino]butan-2-ol (PubChem CID 79359765) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-methyl-4-[(2-propan-2-yloxy-3-pyridinyl)amino]butan-2-ol.
| Compound Name | 2-methyl-4-[(2-propan-2-yloxy-3-pyridinyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 79359765 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2-methyl-4-[(2-propan-2-yloxy-3-pyridinyl)amino]butan-2-ol |
| SMILES | CC(C)Oc1ncccc1NCCC(C)(C)O |
| InChI | InChI=1S/C13H22N2O2/c1-10(2)17-12-11(6-5-8-15-12)14-9-7-13(3,4)16/h5-6,8,10,14,16H,7,9H2,1-4H3 |
| InChIKey | HDFKGRAMMSOOOA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |