C17H22N2O — CID 54805936
N'-(2,3-dimethylphenyl)-N-(4-methoxyphenyl)ethane-1,2-diamine (PubChem CID 54805936) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is N'-(2,3-dimethylphenyl)-N-(4-methoxyphenyl)ethane-1,2-diamine.
| Compound Name | N'-(2,3-dimethylphenyl)-N-(4-methoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54805936 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | N'-(2,3-dimethylphenyl)-N-(4-methoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1ccc(NCCNc2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C17H22N2O/c1-13-5-4-6-17(14(13)2)19-12-11-18-15-7-9-16(20-3)10-8-15/h4-10,18-19H,11-12H2,1-3H3 |
| InChIKey | VNFQLGZCBDQXKS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|