C13H21N3S — CID 28601052
2-[2-(diethylamino)ethylamino]benzenecarbothioamide (PubChem CID 28601052) has the molecular formula C13H21N3S and a molecular weight of 251.40 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylamino]benzenecarbothioamide.
| Compound Name | 2-[2-(diethylamino)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 28601052 |
| Molecular Formula | C13H21N3S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-[2-(diethylamino)ethylamino]benzenecarbothioamide |
| SMILES | CCN(CC)CCNc1ccccc1C(N)=S |
| InChI | InChI=1S/C13H21N3S/c1-3-16(4-2)10-9-15-12-8-6-5-7-11(12)13(14)17/h5-8,15H,3-4,9-10H2,1-2H3,(H2,14,17) |
| InChIKey | ZAFTUPDAYIZBCD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|