C17H21N3S — CID 28601359
2-[3-(N-methylanilino)propylamino]benzenecarbothioamide (PubChem CID 28601359) has the molecular formula C17H21N3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-[3-(N-methylanilino)propylamino]benzenecarbothioamide.
| Compound Name | 2-[3-(N-methylanilino)propylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 28601359 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-[3-(N-methylanilino)propylamino]benzenecarbothioamide |
| SMILES | CN(CCCNc1ccccc1C(N)=S)c1ccccc1 |
| InChI | InChI=1S/C17H21N3S/c1-20(14-8-3-2-4-9-14)13-7-12-19-16-11-6-5-10-15(16)17(18)21/h2-6,8-11,19H,7,12-13H2,1H3,(H2,18,21) |
| InChIKey | ZGZVEXLECWEZQR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|