C12H17Br3N2 — CID 28992090
N',N'-diethyl-N-(2,4,6-tribromophenyl)ethane-1,2-diamine (PubChem CID 28992090) has the molecular formula C12H17Br3N2 and a molecular weight of 428.99 g/mol. Its IUPAC name is N',N'-diethyl-N-(2,4,6-tribromophenyl)ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-(2,4,6-tribromophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 28992090 |
| Molecular Formula | C12H17Br3N2 |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 425.89 |
| IUPAC Name | N',N'-diethyl-N-(2,4,6-tribromophenyl)ethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C12H17Br3N2/c1-3-17(4-2)6-5-16-12-10(14)7-9(13)8-11(12)15/h7-8,16H,3-6H2,1-2H3 |
| InChIKey | ODCYZLCYFBPSQS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |