C17H31N3O — CID 69267318
1-N-butyl-4-[3-(diethylamino)propoxy]benzene-1,2-diamine (PubChem CID 69267318) has the molecular formula C17H31N3O and a molecular weight of 293.45 g/mol. Its IUPAC name is 1-N-butyl-4-[3-(diethylamino)propoxy]benzene-1,2-diamine.
| Compound Name | 1-N-butyl-4-[3-(diethylamino)propoxy]benzene-1,2-diamine |
|---|---|
| PubChem CID | 69267318 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 1-N-butyl-4-[3-(diethylamino)propoxy]benzene-1,2-diamine |
| SMILES | CCCCNc1ccc(OCCCN(CC)CC)cc1N |
| InChI | InChI=1S/C17H31N3O/c1-4-7-11-19-17-10-9-15(14-16(17)18)21-13-8-12-20(5-2)6-3/h9-10,14,19H,4-8,11-13,18H2,1-3H3 |
| InChIKey | ZJYRNXCWQCUSSF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|