About 2-isocyanato-5-methyl-1,3-dinitrobenzene
2-isocyanato-5-methyl-1,3-dinitrobenzene (PubChem CID 169355114) has the molecular formula C8H5N3O5
and a molecular weight of 223.14 g/mol. Its IUPAC name is 2-isocyanato-5-methyl-1,3-dinitrobenzene.
Molecular Properties
| Compound Name | 2-isocyanato-5-methyl-1,3-dinitrobenzene |
| PubChem CID | 169355114 |
| Molecular Formula | C8H5N3O5 |
| Molecular Weight | 223.14 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 2-isocyanato-5-methyl-1,3-dinitrobenzene |
| SMILES | Cc1cc([N+](=O)[O-])c(N=C=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H5N3O5/c1-5-2-6(10(13)14)8(9-4-12)7(3-5)11(15)16/h2-3H,1H3 |
| InChIKey | XPAISGHHONDMOM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 115.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.14 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanato-5-methyl-1,3-dinitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanato-5-methyl-1,3-dinitrobenzene?
The IUPAC name of 2-isocyanato-5-methyl-1,3-dinitrobenzene (CID 169355114) is 2-isocyanato-5-methyl-1,3-dinitrobenzene.
What is the SMILES notation for 2-isocyanato-5-methyl-1,3-dinitrobenzene?
The canonical SMILES for 2-isocyanato-5-methyl-1,3-dinitrobenzene is Cc1cc([N+](=O)[O-])c(N=C=O)c([N+](=O)[O-])c1.
What is the InChIKey of 2-isocyanato-5-methyl-1,3-dinitrobenzene?
The InChIKey is XPAISGHHONDMOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O5/c1-5-2-6(10(13)14)8(9-4-12)7(3-5)11(15)16/h2-3H,1H3.
What are the key properties of 2-isocyanato-5-methyl-1,3-dinitrobenzene?
2-isocyanato-5-methyl-1,3-dinitrobenzene has a molecular weight of 223.14 g/mol, XLogP of 1.78, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanato-5-methyl-1,3-dinitrobenzene is sourced from PubChem (CID 169355114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).