C14H19Cl3N4O7 — CID 145453338
2-chloroethyl-bis(3-chloropropyl)azanium;2,4,6-trinitrophenolate (PubChem CID 145453338) has the molecular formula C14H19Cl3N4O7 and a molecular weight of 461.69 g/mol. Its IUPAC name is 2-chloroethyl-bis(3-chloropropyl)azanium;2,4,6-trinitrophenolate.
| Compound Name | 2-chloroethyl-bis(3-chloropropyl)azanium;2,4,6-trinitrophenolate |
|---|---|
| PubChem CID | 145453338 |
| Molecular Formula | C14H19Cl3N4O7 |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | 2-chloroethyl-bis(3-chloropropyl)azanium;2,4,6-trinitrophenolate |
| SMILES | ClCCC[NH+](CCCl)CCCCl.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H16Cl3N.C6H3N3O7/c9-3-1-6-12(8-5-11)7-2-4-10;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-8H2;1-2,10H |
| InChIKey | MMVQGJLDCWQDCV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 156.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|