C14H22N2O2 — CID 143559037
2-(3,3-dimethylbut-1-en-2-yl)-4-nitroaniline;ethane (PubChem CID 143559037) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-(3,3-dimethylbut-1-en-2-yl)-4-nitroaniline;ethane.
| Compound Name | 2-(3,3-dimethylbut-1-en-2-yl)-4-nitroaniline;ethane |
|---|---|
| PubChem CID | 143559037 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-(3,3-dimethylbut-1-en-2-yl)-4-nitroaniline;ethane |
| SMILES | C=C(c1cc([N+](=O)[O-])ccc1N)C(C)(C)C.CC |
| InChI | InChI=1S/C12H16N2O2.C2H6/c1-8(12(2,3)4)10-7-9(14(15)16)5-6-11(10)13;1-2/h5-7H,1,13H2,2-4H3;1-2H3 |
| InChIKey | KKPJBIYOIYFOTN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|